C20H20N6O2 — CID 143026198
ethyl 4-(6-aminoindazol-1-yl)-5-methyl-3-(methyliminomethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate (PubChem CID 143026198) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is ethyl 4-(6-aminoindazol-1-yl)-5-methyl-3-(methyliminomethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate.
| Compound Name | ethyl 4-(6-aminoindazol-1-yl)-5-methyl-3-(methyliminomethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate |
|---|---|
| PubChem CID | 143026198 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | ethyl 4-(6-aminoindazol-1-yl)-5-methyl-3-(methyliminomethyl)pyrrolo[1,2-b]pyridazine-6-carboxylate |
| SMILES | CCOC(=O)c1cn2ncc(/C=N\C)c(-n3ncc4ccc(N)cc43)c2c1C |
| InChI | InChI=1S/C20H20N6O2/c1-4-28-20(27)16-11-25-18(12(16)2)19(14(8-22-3)10-23-25)26-17-7-15(21)6-5-13(17)9-24-26/h5-11H,4,21H2,1-3H3/b22-8- |
| InChIKey | YYGTVVHTFXPFFR-UYOCIXKTSA-N |
| XLogP | 2.79 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|