C12H15N5O2 — CID 143027101
ethyl (2Z)-1,7-diamino-2-hydrazinylidenequinoline-3-carboxylate (PubChem CID 143027101) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is ethyl (2Z)-1,7-diamino-2-hydrazinylidenequinoline-3-carboxylate.
| Compound Name | ethyl (2Z)-1,7-diamino-2-hydrazinylidenequinoline-3-carboxylate |
|---|---|
| PubChem CID | 143027101 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | ethyl (2Z)-1,7-diamino-2-hydrazinylidenequinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(N)cc2n(N)/c1=N\N |
| InChI | InChI=1S/C12H15N5O2/c1-2-19-12(18)9-5-7-3-4-8(13)6-10(7)17(15)11(9)16-14/h3-6H,2,13-15H2,1H3/b16-11- |
| InChIKey | QOUDRKFDEXESFO-WJDWOHSUSA-N |
| XLogP | -0.11 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|