C16H17FN4O3 — CID 143027080
7-fluoro-2-imino-1-methanimidoyl-N-(oxan-2-yloxy)quinoline-3-carboxamide (PubChem CID 143027080) has the molecular formula C16H17FN4O3 and a molecular weight of 332.33 g/mol. Its IUPAC name is 7-fluoro-2-imino-1-methanimidoyl-N-(oxan-2-yloxy)quinoline-3-carboxamide.
| Compound Name | 7-fluoro-2-imino-1-methanimidoyl-N-(oxan-2-yloxy)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 143027080 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 7-fluoro-2-imino-1-methanimidoyl-N-(oxan-2-yloxy)quinoline-3-carboxamide |
| SMILES | [H]/N=C/n1/c(=N/[H])c(C(=O)NOC2CCCCO2)cc2ccc(F)cc21 |
| InChI | InChI=1S/C16H17FN4O3/c17-11-5-4-10-7-12(15(19)21(9-18)13(10)8-11)16(22)20-24-14-3-1-2-6-23-14/h4-5,7-9,14,18-19H,1-3,6H2,(H,20,22)/b18-9+,19-15+ |
| InChIKey | PTXMSBYMALOHQW-RKACFXBMSA-N |
| XLogP | 1.90 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|