C11H18N2 — CID 143028538
N-[(1Z)-1-(4-methylpiperidin-1-yl)buta-1,3-dienyl]methanimine (PubChem CID 143028538) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-[(1Z)-1-(4-methylpiperidin-1-yl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-(4-methylpiperidin-1-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 143028538 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-[(1Z)-1-(4-methylpiperidin-1-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCC(C)CC1 |
| InChI | InChI=1S/C11H18N2/c1-4-5-11(12-3)13-8-6-10(2)7-9-13/h4-5,10H,1,3,6-9H2,2H3/b11-5+ |
| InChIKey | KIZKHKNLGNGAKC-VZUCSPMQSA-N |
| XLogP | 2.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|