C10H16N2 — CID 144753254
N-[(1Z)-1-piperidin-1-ylbuta-1,3-dienyl]methanimine (PubChem CID 144753254) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(1Z)-1-piperidin-1-ylbuta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-piperidin-1-ylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144753254 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(1Z)-1-piperidin-1-ylbuta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCCCC1 |
| InChI | InChI=1S/C10H16N2/c1-3-7-10(11-2)12-8-5-4-6-9-12/h3,7H,1-2,4-6,8-9H2/b10-7+ |
| InChIKey | YOSFDOVIAQZHDM-JXMROGBWSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|