C12H20N2 — CID 176699174
N-[(1Z)-1-(4-ethylpiperidin-1-yl)buta-1,3-dienyl]methanimine (PubChem CID 176699174) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(1Z)-1-(4-ethylpiperidin-1-yl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z)-1-(4-ethylpiperidin-1-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 176699174 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(1Z)-1-(4-ethylpiperidin-1-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCC(CC)CC1 |
| InChI | InChI=1S/C12H20N2/c1-4-6-12(13-3)14-9-7-11(5-2)8-10-14/h4,6,11H,1,3,5,7-10H2,2H3/b12-6+ |
| InChIKey | WGTZLQOPHKEFHV-WUXMJOGZSA-N |
| XLogP | 2.84 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|