About N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine
N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine (PubChem CID 143649081) has the molecular formula C16H28N4
and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine |
| PubChem CID | 143649081 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)N1CCN(CCN2CCCCC2)CC1 |
| InChI | InChI=1S/C16H28N4/c1-3-7-16(17-2)20-14-12-19(13-15-20)11-10-18-8-5-4-6-9-18/h3,7H,1-2,4-6,8-15H2/b16-7+ |
| InChIKey | GSKDSEOAWUJJEJ-FRKPEAEDSA-N |
| XLogP | 1.82 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine?
The IUPAC name of N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine (CID 143649081) is N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine?
The canonical SMILES for N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine is C=C/C=C(\N=C)N1CCN(CCN2CCCCC2)CC1.
What is the InChIKey of N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine?
The InChIKey is GSKDSEOAWUJJEJ-FRKPEAEDSA-N. The full InChI is InChI=1S/C16H28N4/c1-3-7-16(17-2)20-14-12-19(13-15-20)11-10-18-8-5-4-6-9-18/h3,7H,1-2,4-6,8-15H2/b16-7+.
What are the key properties of N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine?
N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine has a molecular weight of 276.43 g/mol, XLogP of 1.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-[4-(2-piperidin-1-ylethyl)piperazin-1-yl]buta-1,3-dienyl]methanimine is sourced from PubChem (CID 143649081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).