C28H26FN3O — CID 143029172
N-[2-(benzylamino)-4-pyridinyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide (PubChem CID 143029172) has the molecular formula C28H26FN3O and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[2-(benzylamino)-4-pyridinyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide.
| Compound Name | N-[2-(benzylamino)-4-pyridinyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 143029172 |
| Molecular Formula | C28H26FN3O |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[2-(benzylamino)-4-pyridinyl]-N-[(4-fluorophenyl)methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N(Cc1ccc(F)cc1)c1ccnc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H26FN3O/c29-25-14-11-24(12-15-25)21-32(28(33)16-13-22-7-3-1-4-8-22)26-17-18-30-27(19-26)31-20-23-9-5-2-6-10-23/h1-12,14-15,17-19H,13,16,20-21H2,(H,30,31) |
| InChIKey | JHJJOBDFUIKIIQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |