C29H26FN3O — CID 58702326
(E)-N-[(4-fluorophenyl)methyl]-3-phenyl-N-[2-[[(1S)-1-phenylethyl]amino]-4-pyridinyl]prop-2-enamide (PubChem CID 58702326) has the molecular formula C29H26FN3O and a molecular weight of 451.55 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)methyl]-3-phenyl-N-[2-[[(1S)-1-phenylethyl]amino]-4-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)methyl]-3-phenyl-N-[2-[[(1S)-1-phenylethyl]amino]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 58702326 |
| Molecular Formula | C29H26FN3O |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)methyl]-3-phenyl-N-[2-[[(1S)-1-phenylethyl]amino]-4-pyridinyl]prop-2-enamide |
| SMILES | C[C@H](Nc1cc(N(Cc2ccc(F)cc2)C(=O)/C=C/c2ccccc2)ccn1)c1ccccc1 |
| InChI | InChI=1S/C29H26FN3O/c1-22(25-10-6-3-7-11-25)32-28-20-27(18-19-31-28)33(21-24-12-15-26(30)16-13-24)29(34)17-14-23-8-4-2-5-9-23/h2-20,22H,21H2,1H3,(H,31,32)/b17-14+/t22-/m0/s1 |
| InChIKey | KUKOLGBTDGKPFC-QMPJNXRZSA-N |
| XLogP | 6.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|