C13H15N3O — CID 143029349
2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 143029349) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 143029349 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | C=C/C=C(\C=C)c1nc2c(c(=O)[nH]1)CCNC2 |
| InChI | InChI=1S/C13H15N3O/c1-3-5-9(4-2)12-15-11-8-14-7-6-10(11)13(17)16-12/h3-5,14H,1-2,6-8H2,(H,15,16,17)/b9-5+ |
| InChIKey | UNKDYTMXLHCNMH-WEVVVXLNSA-N |
| XLogP | 1.17 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|