C24H35N3O — CID 145481585
4-ethyl-5-[2-[[(3Z,6Z)-octa-3,6-dienyl]amino]ethyl]-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-pyrimidin-6-one (PubChem CID 145481585) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is 4-ethyl-5-[2-[[(3Z,6Z)-octa-3,6-dienyl]amino]ethyl]-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-5-[2-[[(3Z,6Z)-octa-3,6-dienyl]amino]ethyl]-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145481585 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 4-ethyl-5-[2-[[(3Z,6Z)-octa-3,6-dienyl]amino]ethyl]-2-[(2Z)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]-1H-pyrimidin-6-one |
| SMILES | C=C/C=C(\C=C/C)Cc1nc(CC)c(CCNCC/C=C\C/C=C\C)c(=O)[nH]1 |
| InChI | InChI=1S/C24H35N3O/c1-5-9-10-11-12-13-17-25-18-16-21-22(8-4)26-23(27-24(21)28)19-20(14-6-2)15-7-3/h5-7,9,11-12,14-15,25H,2,8,10,13,16-19H2,1,3-4H3,(H,26,27,28)/b9-5-,12-11-,15-7-,20-14+ |
| InChIKey | CNDQJYDIAZJMKG-VEGPZKBMSA-N |
| XLogP | 4.61 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|