C21H27NO4S — CID 143029530
methyl 2-[[2-[(3E,5Z)-6,7-dimethylocta-1,3,5-trien-3-yl]oxyacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 143029530) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is methyl 2-[[2-[(3E,5Z)-6,7-dimethylocta-1,3,5-trien-3-yl]oxyacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(3E,5Z)-6,7-dimethylocta-1,3,5-trien-3-yl]oxyacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 143029530 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 2-[[2-[(3E,5Z)-6,7-dimethylocta-1,3,5-trien-3-yl]oxyacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | C=C/C(=C\C=C(\C)C(C)C)OCC(=O)Nc1sc2c(c1C(=O)OC)CCC2 |
| InChI | InChI=1S/C21H27NO4S/c1-6-15(11-10-14(4)13(2)3)26-12-18(23)22-20-19(21(24)25-5)16-8-7-9-17(16)27-20/h6,10-11,13H,1,7-9,12H2,2-5H3,(H,22,23)/b14-10-,15-11+ |
| InChIKey | QRZVBVWTXYULIT-YCRUPXPOSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|