C14H20N2O3S — CID 61252877
methyl 2-[4-(methylamino)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 61252877) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 2-[4-(methylamino)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(methylamino)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 61252877 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-[4-(methylamino)butanoylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CNCCCC(=O)Nc1sc2c(c1C(=O)OC)CCC2 |
| InChI | InChI=1S/C14H20N2O3S/c1-15-8-4-7-11(17)16-13-12(14(18)19-2)9-5-3-6-10(9)20-13/h15H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | XGARXZUIPZPABN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|