C14H17FO2S — CID 143030195
(3E,7E)-3-fluoro-2-methyl-5,6-dimethylidene-7-methylsulfonyldeca-1,3,7,9-tetraene (PubChem CID 143030195) has the molecular formula C14H17FO2S and a molecular weight of 268.35 g/mol. Its IUPAC name is (3E,7E)-3-fluoro-2-methyl-5,6-dimethylidene-7-methylsulfonyldeca-1,3,7,9-tetraene.
| Compound Name | (3E,7E)-3-fluoro-2-methyl-5,6-dimethylidene-7-methylsulfonyldeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143030195 |
| Molecular Formula | C14H17FO2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (3E,7E)-3-fluoro-2-methyl-5,6-dimethylidene-7-methylsulfonyldeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C(\C(=C)C(=C)/C=C(/F)C(=C)C)S(C)(=O)=O |
| InChI | InChI=1S/C14H17FO2S/c1-7-8-14(18(6,16)17)12(5)11(4)9-13(15)10(2)3/h7-9H,1-2,4-5H2,3,6H3/b13-9+,14-8+ |
| InChIKey | TUEQMVWKLPOKHA-UAUIHIKDSA-N |
| XLogP | 3.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|