C10H21NO2 — CID 143031669
(3R)-3-cyclohexyl-3-(methylamino)propane-1,1-diol (PubChem CID 143031669) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is (3R)-3-cyclohexyl-3-(methylamino)propane-1,1-diol.
| Compound Name | (3R)-3-cyclohexyl-3-(methylamino)propane-1,1-diol |
|---|---|
| PubChem CID | 143031669 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (3R)-3-cyclohexyl-3-(methylamino)propane-1,1-diol |
| SMILES | CN[C@H](CC(O)O)C1CCCCC1 |
| InChI | InChI=1S/C10H21NO2/c1-11-9(7-10(12)13)8-5-3-2-4-6-8/h8-13H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | BOKIBAFDYFUIPE-SECBINFHSA-N |
| XLogP | 0.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|