C15H19ClN2O — CID 143031960
7-chloro-9-ethyl-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one;ethene (PubChem CID 143031960) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 7-chloro-9-ethyl-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one;ethene.
| Compound Name | 7-chloro-9-ethyl-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one;ethene |
|---|---|
| PubChem CID | 143031960 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 7-chloro-9-ethyl-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one;ethene |
| SMILES | C=C.CCc1cc(Cl)c2c(c1)C1CNCCN1C2=O |
| InChI | InChI=1S/C13H15ClN2O.C2H4/c1-2-8-5-9-11-7-15-3-4-16(11)13(17)12(9)10(14)6-8;1-2/h5-6,11,15H,2-4,7H2,1H3;1-2H2 |
| InChIKey | METKLVBTECLUGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|