C20H23ClO2 — CID 143036793
1-[(3-chloro-4-phenylmethoxyphenyl)methyl]cyclohexan-1-ol (PubChem CID 143036793) has the molecular formula C20H23ClO2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 1-[(3-chloro-4-phenylmethoxyphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 1-[(3-chloro-4-phenylmethoxyphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143036793 |
| Molecular Formula | C20H23ClO2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[(3-chloro-4-phenylmethoxyphenyl)methyl]cyclohexan-1-ol |
| SMILES | OC1(Cc2ccc(OCc3ccccc3)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C20H23ClO2/c21-18-13-17(14-20(22)11-5-2-6-12-20)9-10-19(18)23-15-16-7-3-1-4-8-16/h1,3-4,7-10,13,22H,2,5-6,11-12,14-15H2 |
| InChIKey | PFLMWXMLAWSNSF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |