C21H23ClO4 — CID 90735176
[1-(3-chloro-4-phenylmethoxyphenoxy)cyclohexyl] acetate (PubChem CID 90735176) has the molecular formula C21H23ClO4 and a molecular weight of 374.86 g/mol. Its IUPAC name is [1-(3-chloro-4-phenylmethoxyphenoxy)cyclohexyl] acetate.
| Compound Name | [1-(3-chloro-4-phenylmethoxyphenoxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 90735176 |
| Molecular Formula | C21H23ClO4 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [1-(3-chloro-4-phenylmethoxyphenoxy)cyclohexyl] acetate |
| SMILES | CC(=O)OC1(Oc2ccc(OCc3ccccc3)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C21H23ClO4/c1-16(23)25-21(12-6-3-7-13-21)26-18-10-11-20(19(22)14-18)24-15-17-8-4-2-5-9-17/h2,4-5,8-11,14H,3,6-7,12-13,15H2,1H3 |
| InChIKey | YHCFSTIBLCOSJO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|