C36H32Cl2N2O7S — CID 143039674
ethyl 3-[[4-[2-[2-(2,4-dichlorophenyl)-4-oxochromen-3-yl]oxyethoxy]benzoyl]amino]-2-[(4-methylphenyl)sulfanylamino]propanoate (PubChem CID 143039674) has the molecular formula C36H32Cl2N2O7S and a molecular weight of 707.63 g/mol. Its IUPAC name is ethyl 3-[[4-[2-[2-(2,4-dichlorophenyl)-4-oxochromen-3-yl]oxyethoxy]benzoyl]amino]-2-[(4-methylphenyl)sulfanylamino]propanoate.
| Compound Name | ethyl 3-[[4-[2-[2-(2,4-dichlorophenyl)-4-oxochromen-3-yl]oxyethoxy]benzoyl]amino]-2-[(4-methylphenyl)sulfanylamino]propanoate |
|---|---|
| PubChem CID | 143039674 |
| Molecular Formula | C36H32Cl2N2O7S |
| Molecular Weight | 707.63 g/mol |
| Exact Mass | 706.13 |
| IUPAC Name | ethyl 3-[[4-[2-[2-(2,4-dichlorophenyl)-4-oxochromen-3-yl]oxyethoxy]benzoyl]amino]-2-[(4-methylphenyl)sulfanylamino]propanoate |
| SMILES | CCOC(=O)C(CNC(=O)c1ccc(OCCOc2c(-c3ccc(Cl)cc3Cl)oc3ccccc3c2=O)cc1)NSc1ccc(C)cc1 |
| InChI | InChI=1S/C36H32Cl2N2O7S/c1-3-44-36(43)30(40-48-26-15-8-22(2)9-16-26)21-39-35(42)23-10-13-25(14-11-23)45-18-19-46-34-32(41)28-6-4-5-7-31(28)47-33(34)27-17-12-24(37)20-29(27)38/h4-17,20,30,40H,3,18-19,21H2,1-2H3,(H,39,42) |
| InChIKey | FBGDVTDIBGXNBI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|