C15H23NO4 — CID 143039873
methyl (2Z,4Z)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate (PubChem CID 143039873) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is methyl (2Z,4Z)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 143039873 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | methyl (2Z,4Z)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(Z)-prop-1-enyl]hexa-2,4-dienoate |
| SMILES | C/C=C\C(NC(=O)OC(C)(C)C)=C(/C=C\C)C(=O)OC |
| InChI | InChI=1S/C15H23NO4/c1-7-9-11(13(17)19-6)12(10-8-2)16-14(18)20-15(3,4)5/h7-10H,1-6H3,(H,16,18)/b9-7-,10-8-,12-11- |
| InChIKey | IVAAJURERXLEDE-XUJPKIMESA-N |
| XLogP | 3.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|