C26H28N4O4 — CID 143040009
N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-pyridin-3-ylethyl)carbamoyl]cyclohepta-1,3-diene-1-carboxamide (PubChem CID 143040009) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-pyridin-3-ylethyl)carbamoyl]cyclohepta-1,3-diene-1-carboxamide.
| Compound Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-pyridin-3-ylethyl)carbamoyl]cyclohepta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 143040009 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-pyridin-3-ylethyl)carbamoyl]cyclohepta-1,3-diene-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(CN(CCc2cccnc2)C(=O)NC(=O)C2=CC=CCCC2)cc1)NO |
| InChI | InChI=1S/C26H28N4O4/c31-24(29-34)14-13-20-9-11-22(12-10-20)19-30(17-15-21-6-5-16-27-18-21)26(33)28-25(32)23-7-3-1-2-4-8-23/h1,3,5-7,9-14,16,18,34H,2,4,8,15,17,19H2,(H,29,31)(H,28,32,33)/b14-13+ |
| InChIKey | LCMBXGGABQYKPR-BUHFOSPRSA-N |
| XLogP | 3.55 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|