C25H28F2N4O4 — CID 59687049
2,6-difluoro-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-piperidin-1-ylethyl)carbamoyl]benzamide (PubChem CID 59687049) has the molecular formula C25H28F2N4O4 and a molecular weight of 486.52 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-piperidin-1-ylethyl)carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-piperidin-1-ylethyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 59687049 |
| Molecular Formula | C25H28F2N4O4 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2,6-difluoro-N-[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methyl-(2-piperidin-1-ylethyl)carbamoyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(CN(CCN2CCCCC2)C(=O)NC(=O)c2c(F)cccc2F)cc1)NO |
| InChI | InChI=1S/C25H28F2N4O4/c26-20-5-4-6-21(27)23(20)24(33)28-25(34)31(16-15-30-13-2-1-3-14-30)17-19-9-7-18(8-10-19)11-12-22(32)29-35/h4-12,35H,1-3,13-17H2,(H,29,32)(H,28,33,34)/b12-11+ |
| InChIKey | LWRUQBHCKMQIII-VAWYXSNFSA-N |
| XLogP | 3.32 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|