C23H30N2O3 — CID 143040079
(3Z,5Z)-3-ethenyl-N-(2-phenylethyl)hepta-3,5-dien-1-amine;N-hydroxy-5-methylfuran-2-carboxamide (PubChem CID 143040079) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is (3Z,5Z)-3-ethenyl-N-(2-phenylethyl)hepta-3,5-dien-1-amine;N-hydroxy-5-methylfuran-2-carboxamide.
| Compound Name | (3Z,5Z)-3-ethenyl-N-(2-phenylethyl)hepta-3,5-dien-1-amine;N-hydroxy-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 143040079 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (3Z,5Z)-3-ethenyl-N-(2-phenylethyl)hepta-3,5-dien-1-amine;N-hydroxy-5-methylfuran-2-carboxamide |
| SMILES | C=C/C(=C\C=C/C)CCNCCc1ccccc1.Cc1ccc(C(=O)NO)o1 |
| InChI | InChI=1S/C17H23N.C6H7NO3/c1-3-5-9-16(4-2)12-14-18-15-13-17-10-7-6-8-11-17;1-4-2-3-5(10-4)6(8)7-9/h3-11,18H,2,12-15H2,1H3;2-3,9H,1H3,(H,7,8)/b5-3-,16-9+; |
| InChIKey | SOFCXZWEVZMZFX-GNNNDAFXSA-N |
| XLogP | 4.60 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|