C20H15N3O4 — CID 143040561
4-cyano-1,5-dimethyl-3-[4-(3-nitrophenyl)phenyl]pyrrole-2-carboxylic acid (PubChem CID 143040561) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 4-cyano-1,5-dimethyl-3-[4-(3-nitrophenyl)phenyl]pyrrole-2-carboxylic acid.
| Compound Name | 4-cyano-1,5-dimethyl-3-[4-(3-nitrophenyl)phenyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 143040561 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-cyano-1,5-dimethyl-3-[4-(3-nitrophenyl)phenyl]pyrrole-2-carboxylic acid |
| SMILES | Cc1c(C#N)c(-c2ccc(-c3cccc([N+](=O)[O-])c3)cc2)c(C(=O)O)n1C |
| InChI | InChI=1S/C20H15N3O4/c1-12-17(11-21)18(19(20(24)25)22(12)2)14-8-6-13(7-9-14)15-4-3-5-16(10-15)23(26)27/h3-10H,1-2H3,(H,24,25) |
| InChIKey | XESSSEZKDPYLPD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|