C24H22ClN3O3 — CID 1430408
3-(3-chlorophenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)urea (PubChem CID 1430408) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 1430408 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)urea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccco3)C(=O)Nc3cccc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-2-16-8-9-22-17(11-16)12-18(23(29)27-22)14-28(15-21-7-4-10-31-21)24(30)26-20-6-3-5-19(25)13-20/h3-13H,2,14-15H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | QJSGWUWPDQTKGF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |