C24H37F3N4O2 — CID 143041436
N-[1-[2-(4-acetylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-aminopropanamide;prop-1-ene (PubChem CID 143041436) has the molecular formula C24H37F3N4O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N-[1-[2-(4-acetylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-aminopropanamide;prop-1-ene.
| Compound Name | N-[1-[2-(4-acetylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-aminopropanamide;prop-1-ene |
|---|---|
| PubChem CID | 143041436 |
| Molecular Formula | C24H37F3N4O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-[1-[2-(4-acetylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]-3-methylbutyl]-3-aminopropanamide;prop-1-ene |
| SMILES | C=CC.CC(=O)N1CCN(c2ccc(C(F)(F)F)cc2C(CC(C)C)NC(=O)CCN)CC1 |
| InChI | InChI=1S/C21H31F3N4O2.C3H6/c1-14(2)12-18(26-20(30)6-7-25)17-13-16(21(22,23)24)4-5-19(17)28-10-8-27(9-11-28)15(3)29;1-3-2/h4-5,13-14,18H,6-12,25H2,1-3H3,(H,26,30);3H,1H2,2H3 |
| InChIKey | IIEXBZJVWBBZDP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|