C11H17N3O2 — CID 143043740
N-methyl-N'-[(Z)-2-[(Z)-prop-1-enyl]iminopent-3-enyl]oxamide (PubChem CID 143043740) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N-methyl-N'-[(Z)-2-[(Z)-prop-1-enyl]iminopent-3-enyl]oxamide.
| Compound Name | N-methyl-N'-[(Z)-2-[(Z)-prop-1-enyl]iminopent-3-enyl]oxamide |
|---|---|
| PubChem CID | 143043740 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N-methyl-N'-[(Z)-2-[(Z)-prop-1-enyl]iminopent-3-enyl]oxamide |
| SMILES | C/C=C\N=C(/C=C\C)CNC(=O)C(=O)NC |
| InChI | InChI=1S/C11H17N3O2/c1-4-6-9(13-7-5-2)8-14-11(16)10(15)12-3/h4-7H,8H2,1-3H3,(H,12,15)(H,14,16)/b6-4-,7-5-,13-9+ |
| InChIKey | DLBUNCBKQZQGIQ-CJMJIQSHSA-N |
| XLogP | 0.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|