C24H24ClNO3 — CID 143046126
ethyl 3-[2-chloro-4-(3-phenylmethoxyanilino)phenyl]propanoate (PubChem CID 143046126) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is ethyl 3-[2-chloro-4-(3-phenylmethoxyanilino)phenyl]propanoate.
| Compound Name | ethyl 3-[2-chloro-4-(3-phenylmethoxyanilino)phenyl]propanoate |
|---|---|
| PubChem CID | 143046126 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | ethyl 3-[2-chloro-4-(3-phenylmethoxyanilino)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Nc2cccc(OCc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C24H24ClNO3/c1-2-28-24(27)14-12-19-11-13-21(16-23(19)25)26-20-9-6-10-22(15-20)29-17-18-7-4-3-5-8-18/h3-11,13,15-16,26H,2,12,14,17H2,1H3 |
| InChIKey | WJNCHDWYRZBXAL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |