C21H25ClO3S — CID 70850205
ethyl 3-[4-(3-butoxyphenyl)sulfanyl-2-chlorophenyl]propanoate (PubChem CID 70850205) has the molecular formula C21H25ClO3S and a molecular weight of 392.95 g/mol. Its IUPAC name is ethyl 3-[4-(3-butoxyphenyl)sulfanyl-2-chlorophenyl]propanoate.
| Compound Name | ethyl 3-[4-(3-butoxyphenyl)sulfanyl-2-chlorophenyl]propanoate |
|---|---|
| PubChem CID | 70850205 |
| Molecular Formula | C21H25ClO3S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 3-[4-(3-butoxyphenyl)sulfanyl-2-chlorophenyl]propanoate |
| SMILES | CCCCOc1cccc(Sc2ccc(CCC(=O)OCC)c(Cl)c2)c1 |
| InChI | InChI=1S/C21H25ClO3S/c1-3-5-13-25-17-7-6-8-18(14-17)26-19-11-9-16(20(22)15-19)10-12-21(23)24-4-2/h6-9,11,14-15H,3-5,10,12-13H2,1-2H3 |
| InChIKey | OZONSBCOWJVAIG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|