C15H21BrO4 — CID 69248089
ethyl 3-[4-(4-bromobutoxy)-2-hydroxyphenyl]propanoate (PubChem CID 69248089) has the molecular formula C15H21BrO4 and a molecular weight of 345.23 g/mol. Its IUPAC name is ethyl 3-[4-(4-bromobutoxy)-2-hydroxyphenyl]propanoate.
| Compound Name | ethyl 3-[4-(4-bromobutoxy)-2-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 69248089 |
| Molecular Formula | C15H21BrO4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | ethyl 3-[4-(4-bromobutoxy)-2-hydroxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCCCCBr)cc1O |
| InChI | InChI=1S/C15H21BrO4/c1-2-19-15(18)8-6-12-5-7-13(11-14(12)17)20-10-4-3-9-16/h5,7,11,17H,2-4,6,8-10H2,1H3 |
| InChIKey | QNLCFDRSRRYSTR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|