C29H41ClN4O2 — CID 143046863
(2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide;propan-2-one (PubChem CID 143046863) has the molecular formula C29H41ClN4O2 and a molecular weight of 513.13 g/mol. Its IUPAC name is (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide;propan-2-one.
| Compound Name | (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide;propan-2-one |
|---|---|
| PubChem CID | 143046863 |
| Molecular Formula | C29H41ClN4O2 |
| Molecular Weight | 513.13 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | (2E)-4-chloro-2-[(Z)-3-[5-(1-cyclohexa-1,5-dien-1-ylcyclopropyl)-4-methyl-1,2,4-triazol-3-yl]prop-1-enyl]-N,N-dipropylpenta-2,4-dienamide;propan-2-one |
| SMILES | C=C(Cl)/C=C(\C=C/Cc1nnc(C2(C3=CCCC=C3)CC2)n1C)C(=O)N(CCC)CCC.CC(C)=O |
| InChI | InChI=1S/C26H35ClN4O.C3H6O/c1-5-17-31(18-6-2)24(32)21(19-20(3)27)11-10-14-23-28-29-25(30(23)4)26(15-16-26)22-12-8-7-9-13-22;1-3(2)4/h8,10-13,19H,3,5-7,9,14-18H2,1-2,4H3;1-2H3/b11-10-,21-19+; |
| InChIKey | MJRWLFJUNNAEDP-YZLDOBICSA-N |
| XLogP | 6.14 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.13 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|