C19H22N2O2 — CID 143046953
methyl 2-[2-ethenyl-5-(4-methylphenyl)-3-(2-methylprop-1-enyl)imidazol-4-yl]acetate (PubChem CID 143046953) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is methyl 2-[2-ethenyl-5-(4-methylphenyl)-3-(2-methylprop-1-enyl)imidazol-4-yl]acetate.
| Compound Name | methyl 2-[2-ethenyl-5-(4-methylphenyl)-3-(2-methylprop-1-enyl)imidazol-4-yl]acetate |
|---|---|
| PubChem CID | 143046953 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | methyl 2-[2-ethenyl-5-(4-methylphenyl)-3-(2-methylprop-1-enyl)imidazol-4-yl]acetate |
| SMILES | C=Cc1nc(-c2ccc(C)cc2)c(CC(=O)OC)n1C=C(C)C |
| InChI | InChI=1S/C19H22N2O2/c1-6-17-20-19(15-9-7-14(4)8-10-15)16(11-18(22)23-5)21(17)12-13(2)3/h6-10,12H,1,11H2,2-5H3 |
| InChIKey | UWLJYWKTIPVZME-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |