C25H20BrN5O4 — CID 143047837
3-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole;ethane (PubChem CID 143047837) has the molecular formula C25H20BrN5O4 and a molecular weight of 534.37 g/mol. Its IUPAC name is 3-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole;ethane.
| Compound Name | 3-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole;ethane |
|---|---|
| PubChem CID | 143047837 |
| Molecular Formula | C25H20BrN5O4 |
| Molecular Weight | 534.37 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 3-[4,5-bis(4-nitrophenyl)-1H-imidazol-2-yl]-5-bromo-1H-indole;ethane |
| SMILES | CC.O=[N+]([O-])c1ccc(-c2nc(-c3c[nH]c4ccc(Br)cc34)[nH]c2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H14BrN5O4.C2H6/c24-15-5-10-20-18(11-15)19(12-25-20)23-26-21(13-1-6-16(7-2-13)28(30)31)22(27-23)14-3-8-17(9-4-14)29(32)33;1-2/h1-12,25H,(H,26,27);1-2H3 |
| InChIKey | UAVGWBWYIMNDQI-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.37 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|