C8H11N3 — CID 143048748
4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,2,4-triazole (PubChem CID 143048748) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 143048748 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,2,4-triazole |
| SMILES | C=C/C=C\n1c(C)nnc1C |
| InChI | InChI=1S/C8H11N3/c1-4-5-6-11-7(2)9-10-8(11)3/h4-6H,1H2,2-3H3/b6-5- |
| InChIKey | SDYKKEGUNSFLDD-WAYWQWQTSA-N |
| XLogP | 1.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|