C16H22N2OS — CID 143048845
2-methyl-1-(1-sulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-one (PubChem CID 143048845) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-methyl-1-(1-sulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-one.
| Compound Name | 2-methyl-1-(1-sulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-one |
|---|---|
| PubChem CID | 143048845 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-methyl-1-(1-sulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)propan-1-one |
| SMILES | CC(C)C(=O)N1CCC2(CC1)CN(S)c1ccccc12 |
| InChI | InChI=1S/C16H22N2OS/c1-12(2)15(19)17-9-7-16(8-10-17)11-18(20)14-6-4-3-5-13(14)16/h3-6,12,20H,7-11H2,1-2H3 |
| InChIKey | LHGFNFAPFSACGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|