C30H42N4O2S2 — CID 143048878
1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-3-phenylmethoxy-2-(2-piperidin-1-ylethylsulfanylamino)propan-1-one (PubChem CID 143048878) has the molecular formula C30H42N4O2S2 and a molecular weight of 554.83 g/mol. Its IUPAC name is 1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-3-phenylmethoxy-2-(2-piperidin-1-ylethylsulfanylamino)propan-1-one.
| Compound Name | 1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-3-phenylmethoxy-2-(2-piperidin-1-ylethylsulfanylamino)propan-1-one |
|---|---|
| PubChem CID | 143048878 |
| Molecular Formula | C30H42N4O2S2 |
| Molecular Weight | 554.83 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-3-phenylmethoxy-2-(2-piperidin-1-ylethylsulfanylamino)propan-1-one |
| SMILES | CSN1CC2(CCN(C(=O)C(COCc3ccccc3)NSCCN3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C30H42N4O2S2/c1-37-34-24-30(26-12-6-7-13-28(26)34)14-18-33(19-15-30)29(35)27(23-36-22-25-10-4-2-5-11-25)31-38-21-20-32-16-8-3-9-17-32/h2,4-7,10-13,27,31H,3,8-9,14-24H2,1H3 |
| InChIKey | QADMQQQIWXMWSK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|