C34H50N4O3S — CID 143048892
N-[(Z)-3-methylbut-1-enyl]ethanimine;N-[1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]formamide;propane (PubChem CID 143048892) has the molecular formula C34H50N4O3S and a molecular weight of 594.87 g/mol. Its IUPAC name is N-[(Z)-3-methylbut-1-enyl]ethanimine;N-[1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]formamide;propane.
| Compound Name | N-[(Z)-3-methylbut-1-enyl]ethanimine;N-[1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]formamide;propane |
|---|---|
| PubChem CID | 143048892 |
| Molecular Formula | C34H50N4O3S |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.36 |
| IUPAC Name | N-[(Z)-3-methylbut-1-enyl]ethanimine;N-[1-(1-methylsulfanylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-phenylmethoxypropan-2-yl]formamide;propane |
| SMILES | C/C=N/C=C\C(C)C.CCC.CSN1CC2(CCN(C(=O)C(COCc3ccccc3)NC=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H29N3O3S.C7H13N.C3H8/c1-31-27-17-24(20-9-5-6-10-22(20)27)11-13-26(14-12-24)23(29)21(25-18-28)16-30-15-19-7-3-2-4-8-19;1-4-8-6-5-7(2)3;1-3-2/h2-10,18,21H,11-17H2,1H3,(H,25,28);4-7H,1-3H3;3H2,1-2H3/b;6-5-,8-4+; |
| InChIKey | FRWXIWUBYPVLMV-ASQUBNKKSA-N |
| XLogP | 6.64 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|