C25H38N4O2 — CID 143051819
ethane;2-formamido-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide;N-methylaniline (PubChem CID 143051819) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is ethane;2-formamido-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide;N-methylaniline.
| Compound Name | ethane;2-formamido-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide;N-methylaniline |
|---|---|
| PubChem CID | 143051819 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | ethane;2-formamido-N-methyl-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide;N-methylaniline |
| SMILES | CC.CN(C(=O)CNC=O)C(CN1CCCC1)c1ccccc1.CNc1ccccc1 |
| InChI | InChI=1S/C16H23N3O2.C7H9N.C2H6/c1-18(16(21)11-17-13-20)15(12-19-9-5-6-10-19)14-7-3-2-4-8-14;1-8-7-5-3-2-4-6-7;1-2/h2-4,7-8,13,15H,5-6,9-12H2,1H3,(H,17,20);2-6,8H,1H3;1-2H3 |
| InChIKey | RGYWIIULOZGVQN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|