C10H21NO — CID 143051944
(3Z)-5-amino-2,2-dimethylhexa-3,5-dien-3-ol;ethane (PubChem CID 143051944) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (3Z)-5-amino-2,2-dimethylhexa-3,5-dien-3-ol;ethane.
| Compound Name | (3Z)-5-amino-2,2-dimethylhexa-3,5-dien-3-ol;ethane |
|---|---|
| PubChem CID | 143051944 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3Z)-5-amino-2,2-dimethylhexa-3,5-dien-3-ol;ethane |
| SMILES | C=C(N)/C=C(\O)C(C)(C)C.CC |
| InChI | InChI=1S/C8H15NO.C2H6/c1-6(9)5-7(10)8(2,3)4;1-2/h5,10H,1,9H2,2-4H3;1-2H3/b7-5-; |
| InChIKey | ZSQFTGROKCFTPM-YJOCEBFMSA-N |
| XLogP | 2.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|