C11H19NO — CID 126755582
(4E,6E)-6-amino-2,2-dimethyl-3-methylideneocta-4,6-dien-4-ol (PubChem CID 126755582) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4E,6E)-6-amino-2,2-dimethyl-3-methylideneocta-4,6-dien-4-ol.
| Compound Name | (4E,6E)-6-amino-2,2-dimethyl-3-methylideneocta-4,6-dien-4-ol |
|---|---|
| PubChem CID | 126755582 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4E,6E)-6-amino-2,2-dimethyl-3-methylideneocta-4,6-dien-4-ol |
| SMILES | C=C(/C(O)=C\C(N)=C/C)C(C)(C)C |
| InChI | InChI=1S/C11H19NO/c1-6-9(12)7-10(13)8(2)11(3,4)5/h6-7,13H,2,12H2,1,3-5H3/b9-6+,10-7+ |
| InChIKey | WWKJTLIWDZEITC-KZZDLZNXSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|