C11H17NO — CID 143820253
4-amino-2-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-ol;ethane (PubChem CID 143820253) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-amino-2-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-ol;ethane.
| Compound Name | 4-amino-2-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-ol;ethane |
|---|---|
| PubChem CID | 143820253 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-amino-2-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-ol;ethane |
| SMILES | C=c1cc(N)c(=C)c(C)c1O.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-5-4-8(10)6(2)7(3)9(5)11;1-2/h4,11H,1-2,10H2,3H3;1-2H3 |
| InChIKey | RXXAYYFDNYKWAZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|