C26H31N5O3 — CID 143052930
N-[4-[[(E)-N-(2,2-dimethylpentan-3-yloxy)-C-methylcarbonimidoyl]carbamoylamino]phenyl]quinoline-8-carboxamide (PubChem CID 143052930) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[4-[[(E)-N-(2,2-dimethylpentan-3-yloxy)-C-methylcarbonimidoyl]carbamoylamino]phenyl]quinoline-8-carboxamide.
| Compound Name | N-[4-[[(E)-N-(2,2-dimethylpentan-3-yloxy)-C-methylcarbonimidoyl]carbamoylamino]phenyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 143052930 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | N-[4-[[(E)-N-(2,2-dimethylpentan-3-yloxy)-C-methylcarbonimidoyl]carbamoylamino]phenyl]quinoline-8-carboxamide |
| SMILES | CCC(O/N=C(\C)NC(=O)Nc1ccc(NC(=O)c2cccc3cccnc23)cc1)C(C)(C)C |
| InChI | InChI=1S/C26H31N5O3/c1-6-22(26(3,4)5)34-31-17(2)28-25(33)30-20-14-12-19(13-15-20)29-24(32)21-11-7-9-18-10-8-16-27-23(18)21/h7-16,22H,6H2,1-5H3,(H,29,32)(H2,28,30,31,33) |
| InChIKey | XEXXXPZIAQQNGD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|