C24H33N3 — CID 143052978
N-[3-(7H-benzo[7]annulen-4-yl)prop-1-en-2-yl]-3-tert-butyl-1-methylpyrazol-5-amine;ethane (PubChem CID 143052978) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is N-[3-(7H-benzo[7]annulen-4-yl)prop-1-en-2-yl]-3-tert-butyl-1-methylpyrazol-5-amine;ethane.
| Compound Name | N-[3-(7H-benzo[7]annulen-4-yl)prop-1-en-2-yl]-3-tert-butyl-1-methylpyrazol-5-amine;ethane |
|---|---|
| PubChem CID | 143052978 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | N-[3-(7H-benzo[7]annulen-4-yl)prop-1-en-2-yl]-3-tert-butyl-1-methylpyrazol-5-amine;ethane |
| SMILES | C=C(Cc1cccc2c1C=CCC=C2)Nc1cc(C(C)(C)C)nn1C.CC |
| InChI | InChI=1S/C22H27N3.C2H6/c1-16(23-21-15-20(22(2,3)4)24-25(21)5)14-18-12-9-11-17-10-7-6-8-13-19(17)18;1-2/h7-13,15,23H,1,6,14H2,2-5H3;1-2H3 |
| InChIKey | GPJABGIGDUCPFJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |