C16H15ClN2O2S2 — CID 143054492
(Z)-3-amino-2-(4-chlorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enethioamide (PubChem CID 143054492) has the molecular formula C16H15ClN2O2S2 and a molecular weight of 366.90 g/mol. Its IUPAC name is (Z)-3-amino-2-(4-chlorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enethioamide.
| Compound Name | (Z)-3-amino-2-(4-chlorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 143054492 |
| Molecular Formula | C16H15ClN2O2S2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (Z)-3-amino-2-(4-chlorophenyl)-3-(4-methylsulfonylphenyl)prop-2-enethioamide |
| SMILES | CS(=O)(=O)c1ccc(/C(N)=C(/C(N)=S)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN2O2S2/c1-23(20,21)13-8-4-11(5-9-13)15(18)14(16(19)22)10-2-6-12(17)7-3-10/h2-9H,18H2,1H3,(H2,19,22)/b15-14- |
| InChIKey | YOQSPESJYVTLQH-PFONDFGASA-N |
| XLogP | 2.86 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|