C23H27BF2N4O5 — CID 143054574
N-[3-benzyl-2,3-difluoro-1-[(2S)-1-(1,3-oxazol-2-yl)-1-oxobutan-2-yl]-6-oxoazaborinan-5-yl]morpholine-4-carboxamide (PubChem CID 143054574) has the molecular formula C23H27BF2N4O5 and a molecular weight of 488.30 g/mol. Its IUPAC name is N-[3-benzyl-2,3-difluoro-1-[(2S)-1-(1,3-oxazol-2-yl)-1-oxobutan-2-yl]-6-oxoazaborinan-5-yl]morpholine-4-carboxamide.
| Compound Name | N-[3-benzyl-2,3-difluoro-1-[(2S)-1-(1,3-oxazol-2-yl)-1-oxobutan-2-yl]-6-oxoazaborinan-5-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 143054574 |
| Molecular Formula | C23H27BF2N4O5 |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[3-benzyl-2,3-difluoro-1-[(2S)-1-(1,3-oxazol-2-yl)-1-oxobutan-2-yl]-6-oxoazaborinan-5-yl]morpholine-4-carboxamide |
| SMILES | CC[C@@H](C(=O)c1ncco1)N1B(F)C(F)(Cc2ccccc2)CC(NC(=O)N2CCOCC2)C1=O |
| InChI | InChI=1S/C23H27BF2N4O5/c1-2-18(19(31)20-27-8-11-35-20)30-21(32)17(28-22(33)29-9-12-34-13-10-29)15-23(25,24(30)26)14-16-6-4-3-5-7-16/h3-8,11,17-18H,2,9-10,12-15H2,1H3,(H,28,33)/t17?,18-,23?/m0/s1 |
| InChIKey | OJWZFFSXFKEXME-OTQYULQBSA-N |
| XLogP | 2.23 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|