C30H37FN6O3 — CID 143056880
ethyl (2Z)-2-[[[(2E,4Z,6E)-6-[(E)-4-[ethenyl(methyl)amino]but-2-en-2-yl]oxyocta-2,4,6-trien-3-yl]amino]methylimino]-6-(2-fluorophenyl)-1-(methylideneamino)pyrimidine-5-carboxylate (PubChem CID 143056880) has the molecular formula C30H37FN6O3 and a molecular weight of 548.66 g/mol. Its IUPAC name is ethyl (2Z)-2-[[[(2E,4Z,6E)-6-[(E)-4-[ethenyl(methyl)amino]but-2-en-2-yl]oxyocta-2,4,6-trien-3-yl]amino]methylimino]-6-(2-fluorophenyl)-1-(methylideneamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl (2Z)-2-[[[(2E,4Z,6E)-6-[(E)-4-[ethenyl(methyl)amino]but-2-en-2-yl]oxyocta-2,4,6-trien-3-yl]amino]methylimino]-6-(2-fluorophenyl)-1-(methylideneamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 143056880 |
| Molecular Formula | C30H37FN6O3 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | ethyl (2Z)-2-[[[(2E,4Z,6E)-6-[(E)-4-[ethenyl(methyl)amino]but-2-en-2-yl]oxyocta-2,4,6-trien-3-yl]amino]methylimino]-6-(2-fluorophenyl)-1-(methylideneamino)pyrimidine-5-carboxylate |
| SMILES | C=CN(C)C/C=C(\C)OC(/C=C\C(=C/C)NC/N=c1/ncc(C(=O)OCC)c(-c2ccccc2F)n1N=C)=C/C |
| InChI | InChI=1S/C30H37FN6O3/c1-8-23(16-17-24(9-2)40-22(5)18-19-36(7)10-3)34-21-35-30-33-20-26(29(38)39-11-4)28(37(30)32-6)25-14-12-13-15-27(25)31/h8-10,12-18,20,34H,3,6,11,19,21H2,1-2,4-5,7H3/b17-16-,22-18+,23-8+,24-9+,35-30- |
| InChIKey | COWSZMNWPHVGHP-OUDMDYHMSA-N |
| XLogP | 5.14 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|