C13H22O2 — CID 143057505
(E,2R)-2-[[(1R,2S)-2-methylcyclohexyl]methyl]pent-3-enoic acid (PubChem CID 143057505) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (E,2R)-2-[[(1R,2S)-2-methylcyclohexyl]methyl]pent-3-enoic acid.
| Compound Name | (E,2R)-2-[[(1R,2S)-2-methylcyclohexyl]methyl]pent-3-enoic acid |
|---|---|
| PubChem CID | 143057505 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (E,2R)-2-[[(1R,2S)-2-methylcyclohexyl]methyl]pent-3-enoic acid |
| SMILES | C/C=C/[C@@H](C[C@H]1CCCC[C@@H]1C)C(=O)O |
| InChI | InChI=1S/C13H22O2/c1-3-6-12(13(14)15)9-11-8-5-4-7-10(11)2/h3,6,10-12H,4-5,7-9H2,1-2H3,(H,14,15)/b6-3+/t10-,11+,12-/m0/s1 |
| InChIKey | RKSXLCAIVCHVJO-DIAZGMHKSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|