C13H24O — CID 70601692
(Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol (PubChem CID 70601692) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol.
| Compound Name | (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 70601692 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol |
| SMILES | C/C=C\C(O)C1C(C)CCCC1(C)C |
| InChI | InChI=1S/C13H24O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7,10-12,14H,6,8-9H2,1-4H3/b7-5- |
| InChIKey | SHEPIHCKFYQTTF-ALCCZGGFSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|