About (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol
(Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol (PubChem CID 70601692) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol |
| PubChem CID | 70601692 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol |
| SMILES | C/C=C\C(O)C1C(C)CCCC1(C)C |
| InChI | InChI=1S/C13H24O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7,10-12,14H,6,8-9H2,1-4H3/b7-5- |
| InChIKey | SHEPIHCKFYQTTF-ALCCZGGFSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol?
The IUPAC name of (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol (CID 70601692) is (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol.
What is the SMILES notation for (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol?
The canonical SMILES for (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol is C/C=C\C(O)C1C(C)CCCC1(C)C.
What is the InChIKey of (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol?
The InChIKey is SHEPIHCKFYQTTF-ALCCZGGFSA-N. The full InChI is InChI=1S/C13H24O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7,10-12,14H,6,8-9H2,1-4H3/b7-5-.
What are the key properties of (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol?
(Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol has a molecular weight of 196.33 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2,2,6-trimethylcyclohexyl)but-2-en-1-ol is sourced from PubChem (CID 70601692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).