C17H25FO — CID 71116930
(1R)-2-(3-fluorophenyl)-1-[(1R,6S)-2,2,6-trimethylcyclohexyl]ethanol (PubChem CID 71116930) has the molecular formula C17H25FO and a molecular weight of 264.38 g/mol. Its IUPAC name is (1R)-2-(3-fluorophenyl)-1-[(1R,6S)-2,2,6-trimethylcyclohexyl]ethanol.
| Compound Name | (1R)-2-(3-fluorophenyl)-1-[(1R,6S)-2,2,6-trimethylcyclohexyl]ethanol |
|---|---|
| PubChem CID | 71116930 |
| Molecular Formula | C17H25FO |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (1R)-2-(3-fluorophenyl)-1-[(1R,6S)-2,2,6-trimethylcyclohexyl]ethanol |
| SMILES | C[C@H]1CCCC(C)(C)[C@@H]1[C@H](O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H25FO/c1-12-6-5-9-17(2,3)16(12)15(19)11-13-7-4-8-14(18)10-13/h4,7-8,10,12,15-16,19H,5-6,9,11H2,1-3H3/t12-,15+,16-/m0/s1 |
| InChIKey | ULWPYMYHEXQNLY-MAZHCROVSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |