C16H23FO — CID 64731491
1-(3,5-dimethylcyclohexyl)-2-(3-fluorophenyl)ethanol (PubChem CID 64731491) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-(3-fluorophenyl)ethanol.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 64731491 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-(3-fluorophenyl)ethanol |
| SMILES | CC1CC(C)CC(C(O)Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H23FO/c1-11-6-12(2)8-14(7-11)16(18)10-13-4-3-5-15(17)9-13/h3-5,9,11-12,14,16,18H,6-8,10H2,1-2H3 |
| InChIKey | HJTXQMFMDTXAKR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |